C14H14IN3O — CID 158597728
1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-phenylethanone (PubChem CID 158597728) has the molecular formula C14H14IN3O and a molecular weight of 367.19 g/mol. Its IUPAC name is 1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-phenylethanone.
| Compound Name | 1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 158597728 |
| Molecular Formula | C14H14IN3O |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCn2ncc(I)c2C1 |
| InChI | InChI=1S/C14H14IN3O/c15-12-9-16-18-7-6-17(10-13(12)18)14(19)8-11-4-2-1-3-5-11/h1-5,9H,6-8,10H2 |
| InChIKey | PYQBMFFGCXRLHS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|