C18H23N3O2 — CID 158598065
3-[3-[2-(2-methoxyphenyl)ethyl]pyrrolidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 158598065) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[3-[2-(2-methoxyphenyl)ethyl]pyrrolidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[3-[2-(2-methoxyphenyl)ethyl]pyrrolidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 158598065 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[3-[2-(2-methoxyphenyl)ethyl]pyrrolidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | COc1ccccc1CCC1CCN(c2nccn(C)c2=O)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-20-12-10-19-17(18(20)22)21-11-9-14(13-21)7-8-15-5-3-4-6-16(15)23-2/h3-6,10,12,14H,7-9,11,13H2,1-2H3 |
| InChIKey | HVGYNPUKZNTAAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |