C28H22N2O2S — CID 158600689
4-(2-methoxyphenyl)-2-(2-oxo-3-phenylpropyl)sulfanyl-6-phenylpyridine-3-carbonitrile (PubChem CID 158600689) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2-(2-oxo-3-phenylpropyl)sulfanyl-6-phenylpyridine-3-carbonitrile.
| Compound Name | 4-(2-methoxyphenyl)-2-(2-oxo-3-phenylpropyl)sulfanyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 158600689 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-(2-methoxyphenyl)-2-(2-oxo-3-phenylpropyl)sulfanyl-6-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccccc1-c1cc(-c2ccccc2)nc(SCC(=O)Cc2ccccc2)c1C#N |
| InChI | InChI=1S/C28H22N2O2S/c1-32-27-15-9-8-14-23(27)24-17-26(21-12-6-3-7-13-21)30-28(25(24)18-29)33-19-22(31)16-20-10-4-2-5-11-20/h2-15,17H,16,19H2,1H3 |
| InChIKey | FROJHLYYEOFGBW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |