C18H23FO2 — CID 158601352
methyl (2S,5S)-6-(6-fluoro-3H-inden-1-yl)-2,5-dimethylhexanoate (PubChem CID 158601352) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is methyl (2S,5S)-6-(6-fluoro-3H-inden-1-yl)-2,5-dimethylhexanoate.
| Compound Name | methyl (2S,5S)-6-(6-fluoro-3H-inden-1-yl)-2,5-dimethylhexanoate |
|---|---|
| PubChem CID | 158601352 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl (2S,5S)-6-(6-fluoro-3H-inden-1-yl)-2,5-dimethylhexanoate |
| SMILES | COC(=O)[C@@H](C)CC[C@H](C)CC1=CCc2ccc(F)cc21 |
| InChI | InChI=1S/C18H23FO2/c1-12(4-5-13(2)18(20)21-3)10-15-7-6-14-8-9-16(19)11-17(14)15/h7-9,11-13H,4-6,10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | HVRDTVIYSFEGPG-STQMWFEESA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |