About (6-fluoro-3H-inden-1-yl) butanoate
(6-fluoro-3H-inden-1-yl) butanoate (PubChem CID 174543457) has the molecular formula C13H13FO2
and a molecular weight of 220.24 g/mol. Its IUPAC name is (6-fluoro-3H-inden-1-yl) butanoate.
Molecular Properties
| Compound Name | (6-fluoro-3H-inden-1-yl) butanoate |
| PubChem CID | 174543457 |
| Molecular Formula | C13H13FO2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (6-fluoro-3H-inden-1-yl) butanoate |
| SMILES | CCCC(=O)OC1=CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H13FO2/c1-2-3-13(15)16-12-7-5-9-4-6-10(14)8-11(9)12/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | CVCDNZSUUCBRBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-fluoro-3H-inden-1-yl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-3H-inden-1-yl) butanoate?
The IUPAC name of (6-fluoro-3H-inden-1-yl) butanoate (CID 174543457) is (6-fluoro-3H-inden-1-yl) butanoate.
What is the SMILES notation for (6-fluoro-3H-inden-1-yl) butanoate?
The canonical SMILES for (6-fluoro-3H-inden-1-yl) butanoate is CCCC(=O)OC1=CCc2ccc(F)cc21.
What is the InChIKey of (6-fluoro-3H-inden-1-yl) butanoate?
The InChIKey is CVCDNZSUUCBRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO2/c1-2-3-13(15)16-12-7-5-9-4-6-10(14)8-11(9)12/h4,6-8H,2-3,5H2,1H3.
What are the key properties of (6-fluoro-3H-inden-1-yl) butanoate?
(6-fluoro-3H-inden-1-yl) butanoate has a molecular weight of 220.24 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-3H-inden-1-yl) butanoate is sourced from PubChem (CID 174543457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).