C22H40O6 — CID 158603938
2-ethenyl-2-methyloxirane;2-methoxy-2-methylbut-3-en-1-ol;2-(2-methoxy-2-methylbut-3-enoxy)-2-methylbut-3-en-1-ol (PubChem CID 158603938) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-ethenyl-2-methyloxirane;2-methoxy-2-methylbut-3-en-1-ol;2-(2-methoxy-2-methylbut-3-enoxy)-2-methylbut-3-en-1-ol.
| Compound Name | 2-ethenyl-2-methyloxirane;2-methoxy-2-methylbut-3-en-1-ol;2-(2-methoxy-2-methylbut-3-enoxy)-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 158603938 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 2-ethenyl-2-methyloxirane;2-methoxy-2-methylbut-3-en-1-ol;2-(2-methoxy-2-methylbut-3-enoxy)-2-methylbut-3-en-1-ol |
| SMILES | C=CC(C)(CO)OC.C=CC(C)(COC(C)(C=C)CO)OC.C=CC1(C)CO1 |
| InChI | InChI=1S/C11H20O3.C6H12O2.C5H8O/c1-6-10(3,8-12)14-9-11(4,7-2)13-5;1-4-6(2,5-7)8-3;1-3-5(2)4-6-5/h6-7,12H,1-2,8-9H2,3-5H3;4,7H,1,5H2,2-3H3;3H,1,4H2,2H3 |
| InChIKey | HVZDNEJJNLLGNB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|