C18H32O6 — CID 161481650
2-ethenyloxirane;2-methoxybut-3-en-1-ol;2-(2-methoxybut-3-enoxy)but-3-en-1-ol (PubChem CID 161481650) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-ethenyloxirane;2-methoxybut-3-en-1-ol;2-(2-methoxybut-3-enoxy)but-3-en-1-ol.
| Compound Name | 2-ethenyloxirane;2-methoxybut-3-en-1-ol;2-(2-methoxybut-3-enoxy)but-3-en-1-ol |
|---|---|
| PubChem CID | 161481650 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-ethenyloxirane;2-methoxybut-3-en-1-ol;2-(2-methoxybut-3-enoxy)but-3-en-1-ol |
| SMILES | C=CC(CO)OC.C=CC(COC(C=C)CO)OC.C=CC1CO1 |
| InChI | InChI=1S/C9H16O3.C5H10O2.C4H6O/c1-4-8(6-10)12-7-9(5-2)11-3;1-3-5(4-6)7-2;1-2-4-3-5-4/h4-5,8-10H,1-2,6-7H2,3H3;3,5-6H,1,4H2,2H3;2,4H,1,3H2 |
| InChIKey | WELBBHZYPBTKIH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|