C8H16O4 — CID 57043047
3-(4-hydroxypent-1-en-3-yloxy)propane-1,2-diol (PubChem CID 57043047) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-(4-hydroxypent-1-en-3-yloxy)propane-1,2-diol.
| Compound Name | 3-(4-hydroxypent-1-en-3-yloxy)propane-1,2-diol |
|---|---|
| PubChem CID | 57043047 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-(4-hydroxypent-1-en-3-yloxy)propane-1,2-diol |
| SMILES | C=CC(OCC(O)CO)C(C)O |
| InChI | InChI=1S/C8H16O4/c1-3-8(6(2)10)12-5-7(11)4-9/h3,6-11H,1,4-5H2,2H3 |
| InChIKey | XDVSNSWBYDKGPO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|