C19H34O6 — CID 157083568
2-ethenyl-2-methyloxirane;2-(2-hydroxybut-3-enoxy)-2-methylbut-3-en-1-ol;2-methylbut-3-ene-1,2-diol (PubChem CID 157083568) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-ethenyl-2-methyloxirane;2-(2-hydroxybut-3-enoxy)-2-methylbut-3-en-1-ol;2-methylbut-3-ene-1,2-diol.
| Compound Name | 2-ethenyl-2-methyloxirane;2-(2-hydroxybut-3-enoxy)-2-methylbut-3-en-1-ol;2-methylbut-3-ene-1,2-diol |
|---|---|
| PubChem CID | 157083568 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-ethenyl-2-methyloxirane;2-(2-hydroxybut-3-enoxy)-2-methylbut-3-en-1-ol;2-methylbut-3-ene-1,2-diol |
| SMILES | C=CC(C)(O)CO.C=CC(O)COC(C)(C=C)CO.C=CC1(C)CO1 |
| InChI | InChI=1S/C9H16O3.C5H10O2.C5H8O/c1-4-8(11)6-12-9(3,5-2)7-10;1-3-5(2,7)4-6;1-3-5(2)4-6-5/h4-5,8,10-11H,1-2,6-7H2,3H3;3,6-7H,1,4H2,2H3;3H,1,4H2,2H3 |
| InChIKey | ADVHLNOJKDZQCZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|