C29H39NO6S — CID 158606630
[(3S)-oxolan-3-yl] (3R,4S)-3-benzyl-4-hydroxy-5-(10-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-1λ6,2-benzothiazecin-2-yl)pentanoate (PubChem CID 158606630) has the molecular formula C29H39NO6S and a molecular weight of 529.70 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (3R,4S)-3-benzyl-4-hydroxy-5-(10-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-1λ6,2-benzothiazecin-2-yl)pentanoate.
| Compound Name | [(3S)-oxolan-3-yl] (3R,4S)-3-benzyl-4-hydroxy-5-(10-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-1λ6,2-benzothiazecin-2-yl)pentanoate |
|---|---|
| PubChem CID | 158606630 |
| Molecular Formula | C29H39NO6S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | [(3S)-oxolan-3-yl] (3R,4S)-3-benzyl-4-hydroxy-5-(10-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-1λ6,2-benzothiazecin-2-yl)pentanoate |
| SMILES | Cc1ccc2c(c1)CCCCCCN(C[C@@H](O)[C@@H](CC(=O)O[C@H]1CCOC1)Cc1ccccc1)S2(=O)=O |
| InChI | InChI=1S/C29H39NO6S/c1-22-12-13-28-24(17-22)11-7-2-3-8-15-30(37(28,33)34)20-27(31)25(18-23-9-5-4-6-10-23)19-29(32)36-26-14-16-35-21-26/h4-6,9-10,12-13,17,25-27,31H,2-3,7-8,11,14-16,18-21H2,1H3/t25-,26+,27-/m1/s1 |
| InChIKey | DDZTVIKHXXKUPM-KWXIBIRDSA-N |
| XLogP | 4.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |