C24H20O6P2+2 — CID 158608663
benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;hydroxy-[2-(2-hydroxyphenyl)phenyl]-oxophosphanium;hydrate (PubChem CID 158608663) has the molecular formula C24H20O6P2+2 and a molecular weight of 466.37 g/mol. Its IUPAC name is benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;hydroxy-[2-(2-hydroxyphenyl)phenyl]-oxophosphanium;hydrate.
| Compound Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;hydroxy-[2-(2-hydroxyphenyl)phenyl]-oxophosphanium;hydrate |
|---|---|
| PubChem CID | 158608663 |
| Molecular Formula | C24H20O6P2+2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;hydroxy-[2-(2-hydroxyphenyl)phenyl]-oxophosphanium;hydrate |
| SMILES | O.O=[P+](O)c1ccccc1-c1ccccc1O.O=[p+]1oc2ccccc2c2ccccc21 |
| InChI | InChI=1S/C12H9O3P.C12H8O2P.H2O/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)16(14)15;13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15;/h1-8H,(H-,13,14,15);1-8H;1H2/q;+1;/p+1 |
| InChIKey | BABRUSCFKGFQOE-UHFFFAOYSA-O |
| XLogP | 5.92 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|