C14H14N2O4P+ — CID 174856455
benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;formaldehyde;urea (PubChem CID 174856455) has the molecular formula C14H14N2O4P+ and a molecular weight of 305.25 g/mol. Its IUPAC name is benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;formaldehyde;urea.
| Compound Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;formaldehyde;urea |
|---|---|
| PubChem CID | 174856455 |
| Molecular Formula | C14H14N2O4P+ |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;formaldehyde;urea |
| SMILES | C=O.NC(N)=O.O=[p+]1oc2ccccc2c2ccccc21 |
| InChI | InChI=1S/C12H8O2P.CH4N2O.CH2O/c13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15;2-1(3)4;1-2/h1-8H;(H4,2,3,4);1H2/q+1;; |
| InChIKey | YGIQYRXABLUIQF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|