C15H14Cl3O6P2+ — CID 122698441
benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;1,1,2-trichloropropyl dihydrogen phosphate (PubChem CID 122698441) has the molecular formula C15H14Cl3O6P2+ and a molecular weight of 458.58 g/mol. Its IUPAC name is benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;1,1,2-trichloropropyl dihydrogen phosphate.
| Compound Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;1,1,2-trichloropropyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122698441 |
| Molecular Formula | C15H14Cl3O6P2+ |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide;1,1,2-trichloropropyl dihydrogen phosphate |
| SMILES | CC(Cl)C(Cl)(Cl)OP(=O)(O)O.O=[p+]1oc2ccccc2c2ccccc21 |
| InChI | InChI=1S/C12H8O2P.C3H6Cl3O4P/c13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15;1-2(4)3(5,6)10-11(7,8)9/h1-8H;2H,1H3,(H2,7,8,9)/q+1; |
| InChIKey | KEKKRVVURJAPGI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|