C16H22N2O3 — CID 158609676
(3S)-3,5-dimethyl-7-(1,4-oxazepan-4-yl)-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 158609676) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-7-(1,4-oxazepan-4-yl)-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | (3S)-3,5-dimethyl-7-(1,4-oxazepan-4-yl)-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 158609676 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3S)-3,5-dimethyl-7-(1,4-oxazepan-4-yl)-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | C[C@H]1COc2ccc(N3CCCOCC3)cc2N(C)C1=O |
| InChI | InChI=1S/C16H22N2O3/c1-12-11-21-15-5-4-13(10-14(15)17(2)16(12)19)18-6-3-8-20-9-7-18/h4-5,10,12H,3,6-9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | KLXVPQLNGJWRIM-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|