C38H41N3O3 — CID 156681873
(3S)-5-methyl-7-(3-oxa-9-azaspiro[5.5]undecan-9-yl)-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 156681873) has the molecular formula C38H41N3O3 and a molecular weight of 587.76 g/mol. Its IUPAC name is (3S)-5-methyl-7-(3-oxa-9-azaspiro[5.5]undecan-9-yl)-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | (3S)-5-methyl-7-(3-oxa-9-azaspiro[5.5]undecan-9-yl)-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 156681873 |
| Molecular Formula | C38H41N3O3 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | (3S)-5-methyl-7-(3-oxa-9-azaspiro[5.5]undecan-9-yl)-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)[C@@H](NC(c2ccccc2)(c2ccccc2)c2ccccc2)COc2ccc(N3CCC4(CCOCC4)CC3)cc21 |
| InChI | InChI=1S/C38H41N3O3/c1-40-34-27-32(41-23-19-37(20-24-41)21-25-43-26-22-37)17-18-35(34)44-28-33(36(40)42)39-38(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-18,27,33,39H,19-26,28H2,1H3/t33-/m0/s1 |
| InChIKey | AIUBMCBVKLJLNZ-XIFFEERXSA-N |
| XLogP | 6.39 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|