C26H42Cl4O2Si2Ti — CID 158610107
bis(4-[3-[chloro(dimethyl)silyl]propyl]-2,6-dimethylphenol);dichlorotitanium (PubChem CID 158610107) has the molecular formula C26H42Cl4O2Si2Ti and a molecular weight of 632.47 g/mol. Its IUPAC name is bis(4-[3-[chloro(dimethyl)silyl]propyl]-2,6-dimethylphenol);dichlorotitanium.
| Compound Name | bis(4-[3-[chloro(dimethyl)silyl]propyl]-2,6-dimethylphenol);dichlorotitanium |
|---|---|
| PubChem CID | 158610107 |
| Molecular Formula | C26H42Cl4O2Si2Ti |
| Molecular Weight | 632.47 g/mol |
| Exact Mass | 630.10 |
| IUPAC Name | bis(4-[3-[chloro(dimethyl)silyl]propyl]-2,6-dimethylphenol);dichlorotitanium |
| SMILES | Cc1cc(CCC[Si](C)(C)Cl)cc(C)c1O.Cc1cc(CCC[Si](C)(C)Cl)cc(C)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/2C13H21ClOSi.2ClH.Ti/c2*1-10-8-12(9-11(2)13(10)15)6-5-7-16(3,4)14;;;/h2*8-9,15H,5-7H2,1-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | WMBZMZWHNOXSRY-UHFFFAOYSA-L |
| XLogP | 10.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.47 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|