About 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol
10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol (PubChem CID 158614855) has the molecular formula C30H20Br2O3
and a molecular weight of 588.30 g/mol. Its IUPAC name is 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol.
Molecular Properties
| Compound Name | 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol |
| PubChem CID | 158614855 |
| Molecular Formula | C30H20Br2O3 |
| Molecular Weight | 588.30 g/mol |
| Exact Mass | 585.98 |
| IUPAC Name | 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol |
| SMILES | O=C(O)c1cccc2c(Br)c3ccccc3cc12.OCc1cccc2c(Br)c3ccccc3cc12 |
| InChI | InChI=1S/C15H9BrO2.C15H11BrO/c16-14-10-5-2-1-4-9(10)8-13-11(14)6-3-7-12(13)15(17)18;16-15-12-6-2-1-4-10(12)8-14-11(9-17)5-3-7-13(14)15/h1-8H,(H,17,18);1-8,17H,9H2 |
| InChIKey | HXGOGEXOONILLT-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.30 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol?
The IUPAC name of 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol (CID 158614855) is 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol.
What is the SMILES notation for 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol?
The canonical SMILES for 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol is O=C(O)c1cccc2c(Br)c3ccccc3cc12.OCc1cccc2c(Br)c3ccccc3cc12.
What is the InChIKey of 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol?
The InChIKey is HXGOGEXOONILLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrO2.C15H11BrO/c16-14-10-5-2-1-4-9(10)8-13-11(14)6-3-7-12(13)15(17)18;16-15-12-6-2-1-4-10(12)8-14-11(9-17)5-3-7-13(14)15/h1-8H,(H,17,18);1-8,17H,9H2.
What are the key properties of 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol?
10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol has a molecular weight of 588.30 g/mol, XLogP of 8.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromoanthracene-1-carboxylic acid;(10-bromoanthracen-1-yl)methanol is sourced from PubChem (CID 158614855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).