C46H76F4N8O2 — CID 158616916
N'-[[3-(3,3-dimethyl-1-oxaspiro[5.5]undecan-9-yl)-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 158616916) has the molecular formula C46H76F4N8O2 and a molecular weight of 849.16 g/mol. Its IUPAC name is N'-[[3-(3,3-dimethyl-1-oxaspiro[5.5]undecan-9-yl)-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[3-(3,3-dimethyl-1-oxaspiro[5.5]undecan-9-yl)-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 158616916 |
| Molecular Formula | C46H76F4N8O2 |
| Molecular Weight | 849.16 g/mol |
| Exact Mass | 848.60 |
| IUPAC Name | N'-[[3-(3,3-dimethyl-1-oxaspiro[5.5]undecan-9-yl)-5,5-difluoro-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1nn2c(c1C1CCC3(CC1)CCC(C)(C)CO3)CC(F)(F)C2.CNCCN(C)Cc1nn2c(c1C1CCC3(CC1)CCC(C)(C)CO3)CC(F)(F)C2 |
| InChI | InChI=1S/2C23H38F2N4O/c2*1-21(2)9-10-22(30-16-21)7-5-17(6-8-22)20-18(14-28(4)12-11-26-3)27-29-15-23(24,25)13-19(20)29/h2*17,26H,5-16H2,1-4H3 |
| InChIKey | HXMVDXWJPPHLGZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.16 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |