C14H14 — CID 158617170
2-ethyl-1,2-dihydrocyclobuta[b]naphthalene (PubChem CID 158617170) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-ethyl-1,2-dihydrocyclobuta[b]naphthalene.
| Compound Name | 2-ethyl-1,2-dihydrocyclobuta[b]naphthalene |
|---|---|
| PubChem CID | 158617170 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-ethyl-1,2-dihydrocyclobuta[b]naphthalene |
| SMILES | CCC1Cc2cc3ccccc3cc21 |
| InChI | InChI=1S/C14H14/c1-2-10-7-13-8-11-5-3-4-6-12(11)9-14(10)13/h3-6,8-10H,2,7H2,1H3 |
| InChIKey | RXUHSNNNPRHDMW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |