C26H41ClN8O4 — CID 158629129
5-chloro-2-nitroaniline;2-nitro-5-(4-propan-2-ylpiperazin-1-yl)aniline;1-propan-2-ylpiperazine (PubChem CID 158629129) has the molecular formula C26H41ClN8O4 and a molecular weight of 565.12 g/mol. Its IUPAC name is 5-chloro-2-nitroaniline;2-nitro-5-(4-propan-2-ylpiperazin-1-yl)aniline;1-propan-2-ylpiperazine.
| Compound Name | 5-chloro-2-nitroaniline;2-nitro-5-(4-propan-2-ylpiperazin-1-yl)aniline;1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 158629129 |
| Molecular Formula | C26H41ClN8O4 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 5-chloro-2-nitroaniline;2-nitro-5-(4-propan-2-ylpiperazin-1-yl)aniline;1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(c2ccc([N+](=O)[O-])c(N)c2)CC1.CC(C)N1CCNCC1.Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O2.C7H16N2.C6H5ClN2O2/c1-10(2)15-5-7-16(8-6-15)11-3-4-13(17(18)19)12(14)9-11;1-7(2)9-5-3-8-4-6-9;7-4-1-2-6(9(10)11)5(8)3-4/h3-4,9-10H,5-8,14H2,1-2H3;7-8H,3-6H2,1-2H3;1-3H,8H2 |
| InChIKey | HYYXZHNYMIMTNW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|