About 3-butan-2-yl-3H-dioxole;propane
3-butan-2-yl-3H-dioxole;propane (PubChem CID 158632811) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-butan-2-yl-3H-dioxole;propane.
Molecular Properties
| Compound Name | 3-butan-2-yl-3H-dioxole;propane |
| PubChem CID | 158632811 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-butan-2-yl-3H-dioxole;propane |
| SMILES | CCC.CCC(C)C1C=COO1 |
| InChI | InChI=1S/C7H12O2.C3H8/c1-3-6(2)7-4-5-8-9-7;1-3-2/h4-7H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | HZKCDCUXHVZWQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-yl-3H-dioxole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-3H-dioxole;propane?
The IUPAC name of 3-butan-2-yl-3H-dioxole;propane (CID 158632811) is 3-butan-2-yl-3H-dioxole;propane.
What is the SMILES notation for 3-butan-2-yl-3H-dioxole;propane?
The canonical SMILES for 3-butan-2-yl-3H-dioxole;propane is CCC.CCC(C)C1C=COO1.
What is the InChIKey of 3-butan-2-yl-3H-dioxole;propane?
The InChIKey is HZKCDCUXHVZWQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C3H8/c1-3-6(2)7-4-5-8-9-7;1-3-2/h4-7H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of 3-butan-2-yl-3H-dioxole;propane?
3-butan-2-yl-3H-dioxole;propane has a molecular weight of 172.27 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-3H-dioxole;propane is sourced from PubChem (CID 158632811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).