C10H18O2 — CID 134979643
(3S,4S,5S)-3,4-dimethyl-5-methylperoxyhepta-1,6-diene (PubChem CID 134979643) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3S,4S,5S)-3,4-dimethyl-5-methylperoxyhepta-1,6-diene.
| Compound Name | (3S,4S,5S)-3,4-dimethyl-5-methylperoxyhepta-1,6-diene |
|---|---|
| PubChem CID | 134979643 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3S,4S,5S)-3,4-dimethyl-5-methylperoxyhepta-1,6-diene |
| SMILES | C=C[C@H](OOC)[C@@H](C)[C@@H](C)C=C |
| InChI | InChI=1S/C10H18O2/c1-6-8(3)9(4)10(7-2)12-11-5/h6-10H,1-2H2,3-5H3/t8-,9-,10-/m0/s1 |
| InChIKey | TZXKDUPFABCXEH-GUBZILKMSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|