C10H16O2 — CID 101410687
3-ethenyl-4-hydroperoxy-2,5-dimethylhexa-1,5-diene (PubChem CID 101410687) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-ethenyl-4-hydroperoxy-2,5-dimethylhexa-1,5-diene.
| Compound Name | 3-ethenyl-4-hydroperoxy-2,5-dimethylhexa-1,5-diene |
|---|---|
| PubChem CID | 101410687 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-ethenyl-4-hydroperoxy-2,5-dimethylhexa-1,5-diene |
| SMILES | C=CC(C(=C)C)C(OO)C(=C)C |
| InChI | InChI=1S/C10H16O2/c1-6-9(7(2)3)10(12-11)8(4)5/h6,9-11H,1-2,4H2,3,5H3 |
| InChIKey | UHRJQGLGELDGJZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|