C14H26O2 — CID 168873082
3-tert-butyl-4,4-dimethyl-3-prop-2-enylperoxypent-1-ene (PubChem CID 168873082) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-tert-butyl-4,4-dimethyl-3-prop-2-enylperoxypent-1-ene.
| Compound Name | 3-tert-butyl-4,4-dimethyl-3-prop-2-enylperoxypent-1-ene |
|---|---|
| PubChem CID | 168873082 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-tert-butyl-4,4-dimethyl-3-prop-2-enylperoxypent-1-ene |
| SMILES | C=CCOOC(C=C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-9-11-15-16-14(10-2,12(3,4)5)13(6,7)8/h9-10H,1-2,11H2,3-8H3 |
| InChIKey | SGRHLXFYEGOFMI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|