C14H26O2 — CID 171485789
3-butylperoxy-3-ethenyl-4,4-dimethylhex-1-ene (PubChem CID 171485789) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-butylperoxy-3-ethenyl-4,4-dimethylhex-1-ene.
| Compound Name | 3-butylperoxy-3-ethenyl-4,4-dimethylhex-1-ene |
|---|---|
| PubChem CID | 171485789 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-butylperoxy-3-ethenyl-4,4-dimethylhex-1-ene |
| SMILES | C=CC(C=C)(OOCCCC)C(C)(C)CC |
| InChI | InChI=1S/C14H26O2/c1-7-11-12-15-16-14(9-3,10-4)13(5,6)8-2/h9-10H,3-4,7-8,11-12H2,1-2,5-6H3 |
| InChIKey | XUDQNPSNVGBZIU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|