About 3-butan-2-yl-3H-dioxole
3-butan-2-yl-3H-dioxole (PubChem CID 18341890) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-butan-2-yl-3H-dioxole.
Molecular Properties
| Compound Name | 3-butan-2-yl-3H-dioxole |
| PubChem CID | 18341890 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 3-butan-2-yl-3H-dioxole |
| SMILES | CCC(C)C1C=COO1 |
| InChI | InChI=1S/C7H12O2/c1-3-6(2)7-4-5-8-9-7/h4-7H,3H2,1-2H3 |
| InChIKey | JRJLBTGYNMHASF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-yl-3H-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-3H-dioxole?
The IUPAC name of 3-butan-2-yl-3H-dioxole (CID 18341890) is 3-butan-2-yl-3H-dioxole.
What is the SMILES notation for 3-butan-2-yl-3H-dioxole?
The canonical SMILES for 3-butan-2-yl-3H-dioxole is CCC(C)C1C=COO1.
What is the InChIKey of 3-butan-2-yl-3H-dioxole?
The InChIKey is JRJLBTGYNMHASF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-3-6(2)7-4-5-8-9-7/h4-7H,3H2,1-2H3.
What are the key properties of 3-butan-2-yl-3H-dioxole?
3-butan-2-yl-3H-dioxole has a molecular weight of 128.17 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-3H-dioxole is sourced from PubChem (CID 18341890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).