C24H29BrN2O2 — CID 158634627
4-bromo-N-tert-butylbenzamide;N-tert-butyl-4-ethynylbenzamide (PubChem CID 158634627) has the molecular formula C24H29BrN2O2 and a molecular weight of 457.41 g/mol. Its IUPAC name is 4-bromo-N-tert-butylbenzamide;N-tert-butyl-4-ethynylbenzamide.
| Compound Name | 4-bromo-N-tert-butylbenzamide;N-tert-butyl-4-ethynylbenzamide |
|---|---|
| PubChem CID | 158634627 |
| Molecular Formula | C24H29BrN2O2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-bromo-N-tert-butylbenzamide;N-tert-butyl-4-ethynylbenzamide |
| SMILES | C#Cc1ccc(C(=O)NC(C)(C)C)cc1.CC(C)(C)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15NO.C11H14BrNO/c1-5-10-6-8-11(9-7-10)12(15)14-13(2,3)4;1-11(2,3)13-10(14)8-4-6-9(12)7-5-8/h1,6-9H,2-4H3,(H,14,15);4-7H,1-3H3,(H,13,14) |
| InChIKey | HZPRZZOUFBGWIY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|