C22H20Cl3N3O2 — CID 158635604
5-(4-chlorophenyl)-2-[5-(2,6-dichlorophenyl)-2-oxopentyl]-4-prop-2-enyl-1,2,4-triazol-3-one (PubChem CID 158635604) has the molecular formula C22H20Cl3N3O2 and a molecular weight of 464.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[5-(2,6-dichlorophenyl)-2-oxopentyl]-4-prop-2-enyl-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[5-(2,6-dichlorophenyl)-2-oxopentyl]-4-prop-2-enyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 158635604 |
| Molecular Formula | C22H20Cl3N3O2 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[5-(2,6-dichlorophenyl)-2-oxopentyl]-4-prop-2-enyl-1,2,4-triazol-3-one |
| SMILES | C=CCn1c(-c2ccc(Cl)cc2)nn(CC(=O)CCCc2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C22H20Cl3N3O2/c1-2-13-27-21(15-9-11-16(23)12-10-15)26-28(22(27)30)14-17(29)5-3-6-18-19(24)7-4-8-20(18)25/h2,4,7-12H,1,3,5-6,13-14H2 |
| InChIKey | HZSQMSUQUBRPDU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|