C11H9ClN2O2 — CID 142700179
3-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-oxadiazol-5-one (PubChem CID 142700179) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-oxadiazol-5-one.
| Compound Name | 3-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 142700179 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-oxadiazol-5-one |
| SMILES | C=CCn1c(-c2ccc(Cl)cc2)noc1=O |
| InChI | InChI=1S/C11H9ClN2O2/c1-2-7-14-10(13-16-11(14)15)8-3-5-9(12)6-4-8/h2-6H,1,7H2 |
| InChIKey | QODKWULFKLDNBQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|