C21H24ClNO3 — CID 158637805
(5R)-5-amino-9-chloro-1-(4-phenoxyphenyl)nonane-2,6-dione (PubChem CID 158637805) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is (5R)-5-amino-9-chloro-1-(4-phenoxyphenyl)nonane-2,6-dione.
| Compound Name | (5R)-5-amino-9-chloro-1-(4-phenoxyphenyl)nonane-2,6-dione |
|---|---|
| PubChem CID | 158637805 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (5R)-5-amino-9-chloro-1-(4-phenoxyphenyl)nonane-2,6-dione |
| SMILES | N[C@H](CCC(=O)Cc1ccc(Oc2ccccc2)cc1)C(=O)CCCCl |
| InChI | InChI=1S/C21H24ClNO3/c22-14-4-7-21(25)20(23)13-10-17(24)15-16-8-11-19(12-9-16)26-18-5-2-1-3-6-18/h1-3,5-6,8-9,11-12,20H,4,7,10,13-15,23H2/t20-/m1/s1 |
| InChIKey | HZZJUXOWURFYBM-HXUWFJFHSA-N |
| XLogP | 4.29 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|