C18H34O7Si2 — CID 158638196
methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate (PubChem CID 158638196) has the molecular formula C18H34O7Si2 and a molecular weight of 418.64 g/mol. Its IUPAC name is methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate.
| Compound Name | methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
|---|---|
| PubChem CID | 158638196 |
| Molecular Formula | C18H34O7Si2 |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | methyl 6-[[(6-methoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
| SMILES | COC(=O)C(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C18H34O7Si2/c1-23-17(21)15(19)11-7-9-13-26(3,4)25-27(5,6)14-10-8-12-16(20)18(22)24-2/h7-14H2,1-6H3 |
| InChIKey | GHIUMHHNHOGVHN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|