C20H38O7Si2 — CID 158638197
ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate (PubChem CID 158638197) has the molecular formula C20H38O7Si2 and a molecular weight of 446.69 g/mol. Its IUPAC name is ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate.
| Compound Name | ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
|---|---|
| PubChem CID | 158638197 |
| Molecular Formula | C20H38O7Si2 |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | ethyl 6-[[(6-ethoxy-5,6-dioxohexyl)-dimethylsilyl]oxy-dimethylsilyl]-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C20H38O7Si2/c1-7-25-19(23)17(21)13-9-11-15-28(3,4)27-29(5,6)16-12-10-14-18(22)20(24)26-8-2/h7-16H2,1-6H3 |
| InChIKey | XRCQWIHUYQYLMY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|