C9H11N5O2 — CID 158639391
6-morpholin-4-yl-7,9-dihydropurin-8-one (PubChem CID 158639391) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 6-morpholin-4-yl-7,9-dihydropurin-8-one.
| Compound Name | 6-morpholin-4-yl-7,9-dihydropurin-8-one |
|---|---|
| PubChem CID | 158639391 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 6-morpholin-4-yl-7,9-dihydropurin-8-one |
| SMILES | O=c1[nH]c2ncnc(N3CCOCC3)c2[nH]1 |
| InChI | InChI=1S/C9H11N5O2/c15-9-12-6-7(13-9)10-5-11-8(6)14-1-3-16-4-2-14/h5H,1-4H2,(H2,10,11,12,13,15) |
| InChIKey | IAEKBZBTZMZKOE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |