C36H43ClN6O2 — CID 158646526
2-[(1-benzylpiperidin-4-yl)amino]pyridine-3-carboxylic acid;N-(1-benzylpiperidin-4-yl)-3-(chloromethyl)pyridin-2-amine (PubChem CID 158646526) has the molecular formula C36H43ClN6O2 and a molecular weight of 627.23 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]pyridine-3-carboxylic acid;N-(1-benzylpiperidin-4-yl)-3-(chloromethyl)pyridin-2-amine.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]pyridine-3-carboxylic acid;N-(1-benzylpiperidin-4-yl)-3-(chloromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158646526 |
| Molecular Formula | C36H43ClN6O2 |
| Molecular Weight | 627.23 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]pyridine-3-carboxylic acid;N-(1-benzylpiperidin-4-yl)-3-(chloromethyl)pyridin-2-amine |
| SMILES | ClCc1cccnc1NC1CCN(Cc2ccccc2)CC1.O=C(O)c1cccnc1NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22ClN3.C18H21N3O2/c19-13-16-7-4-10-20-18(16)21-17-8-11-22(12-9-17)14-15-5-2-1-3-6-15;22-18(23)16-7-4-10-19-17(16)20-15-8-11-21(12-9-15)13-14-5-2-1-3-6-14/h1-7,10,17H,8-9,11-14H2,(H,20,21);1-7,10,15H,8-9,11-13H2,(H,19,20)(H,22,23) |
| InChIKey | IBAQKUZDGQSMDD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.23 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|