C34H32BBr2IN6O6 — CID 158659019
8-bromo-6-iodo-[1,2,4]triazolo[1,5-a]pyridine;methyl 3-(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoate;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 158659019) has the molecular formula C34H32BBr2IN6O6 and a molecular weight of 918.19 g/mol. Its IUPAC name is 8-bromo-6-iodo-[1,2,4]triazolo[1,5-a]pyridine;methyl 3-(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoate;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | 8-bromo-6-iodo-[1,2,4]triazolo[1,5-a]pyridine;methyl 3-(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoate;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 158659019 |
| Molecular Formula | C34H32BBr2IN6O6 |
| Molecular Weight | 918.19 g/mol |
| Exact Mass | 915.99 |
| IUPAC Name | 8-bromo-6-iodo-[1,2,4]triazolo[1,5-a]pyridine;methyl 3-(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzoate;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | Brc1cc(I)cn2ncnc12.COC(=O)c1cccc(-c2cc(Br)c3ncnn3c2)c1.COC(=O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H19BO4.C14H10BrN3O2.C6H3BrIN3/c1-13(2)14(3,4)19-15(18-13)11-8-6-7-10(9-11)12(16)17-5;1-20-14(19)10-4-2-3-9(5-10)11-6-12(15)13-16-8-17-18(13)7-11;7-5-1-4(8)2-11-6(5)9-3-10-11/h6-9H,1-5H3;2-8H,1H3;1-3H |
| InChIKey | ICNBFZHUWIPINW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 131.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.19 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|