C44H52Cl2N2O4 — CID 158659568
1-(4-chlorophenyl)-3-[4-(2-methoxy-4-pyridinyl)cyclohexyl]butan-2-one (PubChem CID 158659568) has the molecular formula C44H52Cl2N2O4 and a molecular weight of 743.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(2-methoxy-4-pyridinyl)cyclohexyl]butan-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(2-methoxy-4-pyridinyl)cyclohexyl]butan-2-one |
|---|---|
| PubChem CID | 158659568 |
| Molecular Formula | C44H52Cl2N2O4 |
| Molecular Weight | 743.82 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(2-methoxy-4-pyridinyl)cyclohexyl]butan-2-one |
| SMILES | COc1cc(C2CCC(C(C)C(=O)Cc3ccc(Cl)cc3)CC2)ccn1.COc1cc(C2CCC(C(C)C(=O)Cc3ccc(Cl)cc3)CC2)ccn1 |
| InChI | InChI=1S/2C22H26ClNO2/c2*1-15(21(25)13-16-3-9-20(23)10-4-16)17-5-7-18(8-6-17)19-11-12-24-22(14-19)26-2/h2*3-4,9-12,14-15,17-18H,5-8,13H2,1-2H3 |
| InChIKey | ICOSZFRACUFMEV-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.82 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |