C34H30BCl3N8O2 — CID 158665434
5-chloro-3-isocyano-2-(1-methylpyrazol-4-yl)quinoline;2,5-dichloro-3-isocyanoquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 158665434) has the molecular formula C34H30BCl3N8O2 and a molecular weight of 699.84 g/mol. Its IUPAC name is 5-chloro-3-isocyano-2-(1-methylpyrazol-4-yl)quinoline;2,5-dichloro-3-isocyanoquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 5-chloro-3-isocyano-2-(1-methylpyrazol-4-yl)quinoline;2,5-dichloro-3-isocyanoquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 158665434 |
| Molecular Formula | C34H30BCl3N8O2 |
| Molecular Weight | 699.84 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | 5-chloro-3-isocyano-2-(1-methylpyrazol-4-yl)quinoline;2,5-dichloro-3-isocyanoquinoline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1.[C-]#[N+]c1cc2c(Cl)cccc2nc1-c1cnn(C)c1.[C-]#[N+]c1cc2c(Cl)cccc2nc1Cl |
| InChI | InChI=1S/C14H9ClN4.C10H17BN2O2.C10H4Cl2N2/c1-16-13-6-10-11(15)4-3-5-12(10)18-14(13)9-7-17-19(2)8-9;1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8;1-13-9-5-6-7(11)3-2-4-8(6)14-10(9)12/h3-8H,2H3;6-7H,1-5H3;2-5H |
| InChIKey | IDHFCIZDYTVVNP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.84 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|