C24H32N4O8 — CID 158669312
N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione;1-(3-oxobutyl)pyrrole-2,5-dione (PubChem CID 158669312) has the molecular formula C24H32N4O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione;1-(3-oxobutyl)pyrrole-2,5-dione.
| Compound Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione;1-(3-oxobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158669312 |
| Molecular Formula | C24H32N4O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione;1-(3-oxobutyl)pyrrole-2,5-dione |
| SMILES | CC(=O)CCN1C(=O)C=CC1=O.CCCCNC(=O)CCN1C(=O)C=CC1=O.CN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H16N2O3.C8H9NO3.C5H7NO2/c1-2-3-7-12-9(14)6-8-13-10(15)4-5-11(13)16;1-6(10)4-5-9-7(11)2-3-8(9)12;1-6-4(7)2-3-5(6)8/h4-5H,2-3,6-8H2,1H3,(H,12,14);2-3H,4-5H2,1H3;2-3H2,1H3 |
| InChIKey | IDTFGPKLUIBHNC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|