C16H23N3O5 — CID 159705065
N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione (PubChem CID 159705065) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione.
| Compound Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159705065 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-butyl-3-(2,5-dioxopyrrol-1-yl)propanamide;1-methylpyrrolidine-2,5-dione |
| SMILES | CCCCNC(=O)CCN1C(=O)C=CC1=O.CN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H16N2O3.C5H7NO2/c1-2-3-7-12-9(14)6-8-13-10(15)4-5-11(13)16;1-6-4(7)2-3-5(6)8/h4-5H,2-3,6-8H2,1H3,(H,12,14);2-3H2,1H3 |
| InChIKey | MYCKXMJGTINOMY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|