C12H17N3O4 — CID 58831003
4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylbutanamide (PubChem CID 58831003) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylbutanamide.
| Compound Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 58831003 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O4/c1-13-9(16)3-2-7-14-10(17)6-8-15-11(18)4-5-12(15)19/h4-5H,2-3,6-8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | IIKVJRQRIULNGS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|