C52H48F6N2O2 — CID 158671954
1-[(4-tert-butylphenyl)methyl]-5-[4-(trifluoromethoxy)phenyl]indole (PubChem CID 158671954) has the molecular formula C52H48F6N2O2 and a molecular weight of 846.96 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-5-[4-(trifluoromethoxy)phenyl]indole.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-5-[4-(trifluoromethoxy)phenyl]indole |
|---|---|
| PubChem CID | 158671954 |
| Molecular Formula | C52H48F6N2O2 |
| Molecular Weight | 846.96 g/mol |
| Exact Mass | 846.36 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-5-[4-(trifluoromethoxy)phenyl]indole |
| SMILES | CC(C)(C)c1ccc(Cn2ccc3cc(-c4ccc(OC(F)(F)F)cc4)ccc32)cc1.CC(C)(C)c1ccc(Cn2ccc3cc(-c4ccc(OC(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/2C26H24F3NO/c2*1-25(2,3)22-9-4-18(5-10-22)17-30-15-14-21-16-20(8-13-24(21)30)19-6-11-23(12-7-19)31-26(27,28)29/h2*4-16H,17H2,1-3H3 |
| InChIKey | IEBCLYIOKGQROL-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.96 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |