C31H24ClF3N2O — CID 164616863
5,9-dimethyl-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]indol-6-yl]phenanthridin-5-ium chloride (PubChem CID 164616863) has the molecular formula C31H24ClF3N2O and a molecular weight of 532.99 g/mol. Its IUPAC name is 5,9-dimethyl-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]indol-6-yl]phenanthridin-5-ium chloride.
| Compound Name | 5,9-dimethyl-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]indol-6-yl]phenanthridin-5-ium chloride |
|---|---|
| PubChem CID | 164616863 |
| Molecular Formula | C31H24ClF3N2O |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 5,9-dimethyl-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]indol-6-yl]phenanthridin-5-ium chloride |
| SMILES | Cc1ccc2c[n+](C)c3ccc(-c4ccc5ccn(Cc6ccc(OC(F)(F)F)cc6)c5c4)cc3c2c1.[Cl-] |
| InChI | InChI=1S/C31H24F3N2O.ClH/c1-20-3-6-25-19-35(2)29-12-9-23(16-28(29)27(25)15-20)24-8-7-22-13-14-36(30(22)17-24)18-21-4-10-26(11-5-21)37-31(32,33)34;/h3-17,19H,18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PJWFTYUTFKSPIO-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|