C31H28F2N4O3 — CID 158672224
4-(3,5-difluoro-4-phenoxyanilino)-6-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]-7-ethoxyquinoline-3-carbonitrile (PubChem CID 158672224) has the molecular formula C31H28F2N4O3 and a molecular weight of 542.59 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-phenoxyanilino)-6-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]-7-ethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(3,5-difluoro-4-phenoxyanilino)-6-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]-7-ethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 158672224 |
| Molecular Formula | C31H28F2N4O3 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-(3,5-difluoro-4-phenoxyanilino)-6-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]-7-ethoxyquinoline-3-carbonitrile |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3cc(F)c(Oc4ccccc4)c(F)c3)c2cc1CC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C31H28F2N4O3/c1-4-39-29-17-28-25(14-20(29)13-23(38)9-8-12-37(2)3)30(21(18-34)19-35-28)36-22-15-26(32)31(27(33)16-22)40-24-10-6-5-7-11-24/h5-11,14-17,19H,4,12-13H2,1-3H3,(H,35,36)/b9-8+ |
| InChIKey | ROQJXBMJDRUGGB-CMDGGOBGSA-N |
| XLogP | 6.55 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|