C20H22ClN5O5 — CID 158672515
5-chloro-6-ethyl-N-[2-[1-(4-methylphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine;1,2-dihydroperoxyethyne (PubChem CID 158672515) has the molecular formula C20H22ClN5O5 and a molecular weight of 447.88 g/mol. Its IUPAC name is 5-chloro-6-ethyl-N-[2-[1-(4-methylphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine;1,2-dihydroperoxyethyne.
| Compound Name | 5-chloro-6-ethyl-N-[2-[1-(4-methylphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine;1,2-dihydroperoxyethyne |
|---|---|
| PubChem CID | 158672515 |
| Molecular Formula | C20H22ClN5O5 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 5-chloro-6-ethyl-N-[2-[1-(4-methylphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine;1,2-dihydroperoxyethyne |
| SMILES | CCc1ncnc(NCCOc2ccn(-c3ccc(C)cc3)n2)c1Cl.OOC#COO |
| InChI | InChI=1S/C18H20ClN5O.C2H2O4/c1-3-15-17(19)18(22-12-21-15)20-9-11-25-16-8-10-24(23-16)14-6-4-13(2)5-7-14;3-5-1-2-6-4/h4-8,10,12H,3,9,11H2,1-2H3,(H,20,21,22);3-4H |
| InChIKey | IECVAEAIPOIXKR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|