C18H18Cl3N5O — CID 155176710
5-chloro-N-[2-[5-(2,4-dichlorophenyl)-1-methylpyrazol-3-yl]oxyethyl]-6-ethylpyrimidin-4-amine (PubChem CID 155176710) has the molecular formula C18H18Cl3N5O and a molecular weight of 426.74 g/mol. Its IUPAC name is 5-chloro-N-[2-[5-(2,4-dichlorophenyl)-1-methylpyrazol-3-yl]oxyethyl]-6-ethylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-[5-(2,4-dichlorophenyl)-1-methylpyrazol-3-yl]oxyethyl]-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 155176710 |
| Molecular Formula | C18H18Cl3N5O |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 5-chloro-N-[2-[5-(2,4-dichlorophenyl)-1-methylpyrazol-3-yl]oxyethyl]-6-ethylpyrimidin-4-amine |
| SMILES | CCc1ncnc(NCCOc2cc(-c3ccc(Cl)cc3Cl)n(C)n2)c1Cl |
| InChI | InChI=1S/C18H18Cl3N5O/c1-3-14-17(21)18(24-10-23-14)22-6-7-27-16-9-15(26(2)25-16)12-5-4-11(19)8-13(12)20/h4-5,8-10H,3,6-7H2,1-2H3,(H,22,23,24) |
| InChIKey | VQNNIKHMUQZXER-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|