C21H25Cl2N3 — CID 67220286
7-(2,4-dichlorophenyl)-2-ethyl-N-hexylpyrazolo[1,5-a]pyridin-3-amine (PubChem CID 67220286) has the molecular formula C21H25Cl2N3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-2-ethyl-N-hexylpyrazolo[1,5-a]pyridin-3-amine.
| Compound Name | 7-(2,4-dichlorophenyl)-2-ethyl-N-hexylpyrazolo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 67220286 |
| Molecular Formula | C21H25Cl2N3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-2-ethyl-N-hexylpyrazolo[1,5-a]pyridin-3-amine |
| SMILES | CCCCCCNc1c(CC)nn2c(-c3ccc(Cl)cc3Cl)cccc12 |
| InChI | InChI=1S/C21H25Cl2N3/c1-3-5-6-7-13-24-21-18(4-2)25-26-19(9-8-10-20(21)26)16-12-11-15(22)14-17(16)23/h8-12,14,24H,3-7,13H2,1-2H3 |
| InChIKey | JXGAUOIMTIWVBM-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|