C23H20O6 — CID 158672923
3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethene;naphthalene-1-carboxylic acid (PubChem CID 158672923) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethene;naphthalene-1-carboxylic acid.
| Compound Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethene;naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 158672923 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethene;naphthalene-1-carboxylic acid |
| SMILES | C=C.O=C(O)c1cccc2ccccc12.O=C1OCCOC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C11H8O2.C10H8O4.C2H4/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;11-9-7-1-2-8(4-3-7)10(12)14-6-5-13-9;1-2/h1-7H,(H,12,13);1-4H,5-6H2;1-2H2 |
| InChIKey | IEEBOBJWPWIGNW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|