C17H17F3O6S2 — CID 158673625
methyl [4-(thiolan-2-yl)naphthalen-1-yl] carbonate;trifluoromethanesulfonic acid (PubChem CID 158673625) has the molecular formula C17H17F3O6S2 and a molecular weight of 438.45 g/mol. Its IUPAC name is methyl [4-(thiolan-2-yl)naphthalen-1-yl] carbonate;trifluoromethanesulfonic acid.
| Compound Name | methyl [4-(thiolan-2-yl)naphthalen-1-yl] carbonate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158673625 |
| Molecular Formula | C17H17F3O6S2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | methyl [4-(thiolan-2-yl)naphthalen-1-yl] carbonate;trifluoromethanesulfonic acid |
| SMILES | COC(=O)Oc1ccc(C2CCCS2)c2ccccc12.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C16H16O3S.CHF3O3S/c1-18-16(17)19-14-9-8-13(15-7-4-10-20-15)11-5-2-3-6-12(11)14;2-1(3,4)8(5,6)7/h2-3,5-6,8-9,15H,4,7,10H2,1H3;(H,5,6,7) |
| InChIKey | IEGAPEOIAHHWTO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|