C27H26Cl2N4O2 — CID 158674433
12-(3,4-dichlorobenzoyl)-5-(3-methylbutyl)-7-phenyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 158674433) has the molecular formula C27H26Cl2N4O2 and a molecular weight of 509.44 g/mol. Its IUPAC name is 12-(3,4-dichlorobenzoyl)-5-(3-methylbutyl)-7-phenyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 12-(3,4-dichlorobenzoyl)-5-(3-methylbutyl)-7-phenyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 158674433 |
| Molecular Formula | C27H26Cl2N4O2 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 12-(3,4-dichlorobenzoyl)-5-(3-methylbutyl)-7-phenyl-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CC(C)CCc1cnn2c3c(c(=O)n(-c4ccccc4)c12)CCN(C(=O)c1ccc(Cl)c(Cl)c1)C3 |
| InChI | InChI=1S/C27H26Cl2N4O2/c1-17(2)8-9-19-15-30-33-24-16-31(26(34)18-10-11-22(28)23(29)14-18)13-12-21(24)27(35)32(25(19)33)20-6-4-3-5-7-20/h3-7,10-11,14-15,17H,8-9,12-13,16H2,1-2H3 |
| InChIKey | WECQSBBPHYWRHP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |