C26H23N3O4 — CID 158675296
formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]quinoline-6-carboxamide (PubChem CID 158675296) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]quinoline-6-carboxamide.
| Compound Name | formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 158675296 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | formic acid;N-[(4S)-4-(4-methylphenyl)-2,3-dihydropyrano[3,2-b]pyridin-4-yl]quinoline-6-carboxamide |
| SMILES | Cc1ccc([C@@]2(NC(=O)c3ccc4ncccc4c3)CCOc3cccnc32)cc1.O=CO |
| InChI | InChI=1S/C25H21N3O2.CH2O2/c1-17-6-9-20(10-7-17)25(12-15-30-22-5-3-14-27-23(22)25)28-24(29)19-8-11-21-18(16-19)4-2-13-26-21;2-1-3/h2-11,13-14,16H,12,15H2,1H3,(H,28,29);1H,(H,2,3)/t25-;/m0./s1 |
| InChIKey | IEKZGAQJRYRVIC-UQIIZPHYSA-N |
| XLogP | 4.10 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|